C37H41F3N2O8S2 — CID 11571350
[4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] trifluoromethanesulfonate (PubChem CID 11571350) has the molecular formula C37H41F3N2O8S2 and a molecular weight of 762.87 g/mol. Its IUPAC name is [4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11571350 |
| Molecular Formula | C37H41F3N2O8S2 |
| Molecular Weight | 762.87 g/mol |
| Exact Mass | 762.23 |
| IUPAC Name | [4-[4-[benzyl-[(2S)-2-hydroxy-3-[3-(methanesulfonamido)-4-phenylmethoxyphenoxy]propyl]amino]cyclohexyl]phenyl] trifluoromethanesulfonate |
| SMILES | CS(=O)(=O)Nc1cc(OC[C@@H](O)CN(Cc2ccccc2)C2CCC(c3ccc(OS(=O)(=O)C(F)(F)F)cc3)CC2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C37H41F3N2O8S2/c1-51(44,45)41-35-22-34(20-21-36(35)49-25-28-10-6-3-7-11-28)48-26-32(43)24-42(23-27-8-4-2-5-9-27)31-16-12-29(13-17-31)30-14-18-33(19-15-30)50-52(46,47)37(38,39)40/h2-11,14-15,18-22,29,31-32,41,43H,12-13,16-17,23-26H2,1H3/t29?,31?,32-/m0/s1 |
| InChIKey | RVTGKARGJZNPNT-WAPYTIIOSA-N |
| XLogP | 6.83 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.87 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|