C13H25F3N2O — CID 115713640
N-[2-(2-methylpropoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidin-4-amine (PubChem CID 115713640) has the molecular formula C13H25F3N2O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[2-(2-methylpropoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidin-4-amine.
| Compound Name | N-[2-(2-methylpropoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115713640 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[2-(2-methylpropoxy)ethyl]-1-(2,2,2-trifluoroethyl)piperidin-4-amine |
| SMILES | CC(C)COCCNC1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H25F3N2O/c1-11(2)9-19-8-5-17-12-3-6-18(7-4-12)10-13(14,15)16/h11-12,17H,3-10H2,1-2H3 |
| InChIKey | UJOOVWZRXMZCEH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|