C11H19F3N2O — CID 115713799
2-(1-cyclobutylethylamino)-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 115713799) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-(1-cyclobutylethylamino)-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | 2-(1-cyclobutylethylamino)-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 115713799 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(1-cyclobutylethylamino)-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(NC(C)C1CCC1)C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O/c1-7(9-4-3-5-9)16-8(2)10(17)15-6-11(12,13)14/h7-9,16H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | HQJUQUAHMPGIMQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |