C48H48N2 — CID 11571495
1-N,2-N-bis[4-methyl-2-[1-(2,4,6-trimethylphenyl)ethyl]phenyl]acenaphthylene-1,2-diimine (PubChem CID 11571495) has the molecular formula C48H48N2 and a molecular weight of 652.93 g/mol. Its IUPAC name is 1-N,2-N-bis[4-methyl-2-[1-(2,4,6-trimethylphenyl)ethyl]phenyl]acenaphthylene-1,2-diimine.
| Compound Name | 1-N,2-N-bis[4-methyl-2-[1-(2,4,6-trimethylphenyl)ethyl]phenyl]acenaphthylene-1,2-diimine |
|---|---|
| PubChem CID | 11571495 |
| Molecular Formula | C48H48N2 |
| Molecular Weight | 652.93 g/mol |
| Exact Mass | 652.38 |
| IUPAC Name | 1-N,2-N-bis[4-methyl-2-[1-(2,4,6-trimethylphenyl)ethyl]phenyl]acenaphthylene-1,2-diimine |
| SMILES | Cc1cc(C)c(C(C)c2cc(C)ccc2/N=C2C(=N/c3ccc(C)cc3C(C)c3c(C)cc(C)cc3C)/c3cccc4cccc/2c34)c(C)c1 |
| InChI | InChI=1S/C48H48N2/c1-27-17-19-42(40(25-27)35(9)44-31(5)21-29(3)22-32(44)6)49-47-38-15-11-13-37-14-12-16-39(46(37)38)48(47)50-43-20-18-28(2)26-41(43)36(10)45-33(7)23-30(4)24-34(45)8/h11-26,35-36H,1-10H3/b49-47+,50-48+ |
| InChIKey | VMCFZAAVXNDDBK-RYZURTRPSA-N |
| XLogP | 12.87 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.93 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|