C12H26N2O2 — CID 115716335
tert-butyl N-[2-(butan-2-ylamino)ethyl]-N-methylcarbamate (PubChem CID 115716335) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is tert-butyl N-[2-(butan-2-ylamino)ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-(butan-2-ylamino)ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 115716335 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | tert-butyl N-[2-(butan-2-ylamino)ethyl]-N-methylcarbamate |
| SMILES | CCC(C)NCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H26N2O2/c1-7-10(2)13-8-9-14(6)11(15)16-12(3,4)5/h10,13H,7-9H2,1-6H3 |
| InChIKey | URKZNRPNQURXTB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |