C13H18BrN — CID 115717133
2-bromo-N-[1-(3,5-dimethylphenyl)ethyl]prop-2-en-1-amine (PubChem CID 115717133) has the molecular formula C13H18BrN and a molecular weight of 268.20 g/mol. Its IUPAC name is 2-bromo-N-[1-(3,5-dimethylphenyl)ethyl]prop-2-en-1-amine.
| Compound Name | 2-bromo-N-[1-(3,5-dimethylphenyl)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 115717133 |
| Molecular Formula | C13H18BrN |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-bromo-N-[1-(3,5-dimethylphenyl)ethyl]prop-2-en-1-amine |
| SMILES | C=C(Br)CNC(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H18BrN/c1-9-5-10(2)7-13(6-9)12(4)15-8-11(3)14/h5-7,12,15H,3,8H2,1-2,4H3 |
| InChIKey | LEXJMNSXPCRNAQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |