C13H26N2O2 — CID 115717570
N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethoxypropan-2-amine (PubChem CID 115717570) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethoxypropan-2-amine.
| Compound Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethoxypropan-2-amine |
|---|---|
| PubChem CID | 115717570 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-1-ethoxypropan-2-amine |
| SMILES | CCOCC(C)NCC1CN2CCCC2CO1 |
| InChI | InChI=1S/C13H26N2O2/c1-3-16-9-11(2)14-7-13-8-15-6-4-5-12(15)10-17-13/h11-14H,3-10H2,1-2H3 |
| InChIKey | QTUFZHMCGZZYGY-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |