About 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol
3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 115717842) has the molecular formula C11H24N2OS
and a molecular weight of 232.39 g/mol. Its IUPAC name is 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol |
| PubChem CID | 115717842 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | CC1CC(NCCSCCCO)CN1C |
| InChI | InChI=1S/C11H24N2OS/c1-10-8-11(9-13(10)2)12-4-7-15-6-3-5-14/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | NNTSEDPIUKALPW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol?
The IUPAC name of 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol (CID 115717842) is 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol.
What is the SMILES notation for 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol?
The canonical SMILES for 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol is CC1CC(NCCSCCCO)CN1C.
What is the InChIKey of 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol?
The InChIKey is NNTSEDPIUKALPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2OS/c1-10-8-11(9-13(10)2)12-4-7-15-6-3-5-14/h10-12,14H,3-9H2,1-2H3.
What are the key properties of 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol?
3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol has a molecular weight of 232.39 g/mol, XLogP of 0.78, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol is sourced from PubChem (CID 115717842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).