C11H24N2OS — CID 115717842
3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 115717842) has the molecular formula C11H24N2OS and a molecular weight of 232.39 g/mol. Its IUPAC name is 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 115717842 |
| Molecular Formula | C11H24N2OS |
| Molecular Weight | 232.39 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-[2-[(1,5-dimethylpyrrolidin-3-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | CC1CC(NCCSCCCO)CN1C |
| InChI | InChI=1S/C11H24N2OS/c1-10-8-11(9-13(10)2)12-4-7-15-6-3-5-14/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | NNTSEDPIUKALPW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|