About (2S)-1,1-dimethoxy-N-methylpropan-2-amine
(2S)-1,1-dimethoxy-N-methylpropan-2-amine (PubChem CID 11571861) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is (2S)-1,1-dimethoxy-N-methylpropan-2-amine.
Molecular Properties
| Compound Name | (2S)-1,1-dimethoxy-N-methylpropan-2-amine |
| PubChem CID | 11571861 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | (2S)-1,1-dimethoxy-N-methylpropan-2-amine |
| SMILES | CN[C@@H](C)C(OC)OC |
| InChI | InChI=1S/C6H15NO2/c1-5(7-2)6(8-3)9-4/h5-7H,1-4H3/t5-/m0/s1 |
| InChIKey | LZSYQBQWCKOQJL-YFKPBYRVSA-N |
| XLogP | 0.21 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2S)-1,1-dimethoxy-N-methylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1,1-dimethoxy-N-methylpropan-2-amine?
The IUPAC name of (2S)-1,1-dimethoxy-N-methylpropan-2-amine (CID 11571861) is (2S)-1,1-dimethoxy-N-methylpropan-2-amine.
What is the SMILES notation for (2S)-1,1-dimethoxy-N-methylpropan-2-amine?
The canonical SMILES for (2S)-1,1-dimethoxy-N-methylpropan-2-amine is CN[C@@H](C)C(OC)OC.
What is the InChIKey of (2S)-1,1-dimethoxy-N-methylpropan-2-amine?
The InChIKey is LZSYQBQWCKOQJL-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H15NO2/c1-5(7-2)6(8-3)9-4/h5-7H,1-4H3/t5-/m0/s1.
What are the key properties of (2S)-1,1-dimethoxy-N-methylpropan-2-amine?
(2S)-1,1-dimethoxy-N-methylpropan-2-amine has a molecular weight of 133.19 g/mol, XLogP of 0.21, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1,1-dimethoxy-N-methylpropan-2-amine is sourced from PubChem (CID 11571861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).