C12H14O2 — CID 11571937
(E,4R)-4-hydroxy-6-phenylhex-5-en-2-one (PubChem CID 11571937) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (E,4R)-4-hydroxy-6-phenylhex-5-en-2-one.
| Compound Name | (E,4R)-4-hydroxy-6-phenylhex-5-en-2-one |
|---|---|
| PubChem CID | 11571937 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (E,4R)-4-hydroxy-6-phenylhex-5-en-2-one |
| SMILES | CC(=O)C[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C12H14O2/c1-10(13)9-12(14)8-7-11-5-3-2-4-6-11/h2-8,12,14H,9H2,1H3/b8-7+/t12-/m0/s1 |
| InChIKey | UXFOPBHZBIELIF-GUOLPTJISA-N |
| XLogP | 2.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |