C13H23NO2 — CID 115719534
1-[1-(furan-3-yl)ethylamino]-2,3-dimethylpentan-2-ol (PubChem CID 115719534) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-[1-(furan-3-yl)ethylamino]-2,3-dimethylpentan-2-ol.
| Compound Name | 1-[1-(furan-3-yl)ethylamino]-2,3-dimethylpentan-2-ol |
|---|---|
| PubChem CID | 115719534 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | 1-[1-(furan-3-yl)ethylamino]-2,3-dimethylpentan-2-ol |
| SMILES | CCC(C)C(C)(O)CNC(C)c1ccoc1 |
| InChI | InChI=1S/C13H23NO2/c1-5-10(2)13(4,15)9-14-11(3)12-6-7-16-8-12/h6-8,10-11,14-15H,5,9H2,1-4H3 |
| InChIKey | JJODYAOGCLFYJU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |