C15H22BrNOS — CID 115719847
1-(3-bromo-4-methoxyphenyl)-N-(thian-4-ylmethyl)ethanamine (PubChem CID 115719847) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)-N-(thian-4-ylmethyl)ethanamine.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)-N-(thian-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115719847 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)-N-(thian-4-ylmethyl)ethanamine |
| SMILES | COc1ccc(C(C)NCC2CCSCC2)cc1Br |
| InChI | InChI=1S/C15H22BrNOS/c1-11(17-10-12-5-7-19-8-6-12)13-3-4-15(18-2)14(16)9-13/h3-4,9,11-12,17H,5-8,10H2,1-2H3 |
| InChIKey | OSJBVGBQBIJXOD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |