C15H20N2S2 — CID 115719986
1-(1,3-benzothiazol-2-yl)-N-(thian-4-ylmethyl)ethanamine (PubChem CID 115719986) has the molecular formula C15H20N2S2 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(thian-4-ylmethyl)ethanamine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(thian-4-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115719986 |
| Molecular Formula | C15H20N2S2 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(thian-4-ylmethyl)ethanamine |
| SMILES | CC(NCC1CCSCC1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C15H20N2S2/c1-11(16-10-12-6-8-18-9-7-12)15-17-13-4-2-3-5-14(13)19-15/h2-5,11-12,16H,6-10H2,1H3 |
| InChIKey | HWVQJYAKNOZKID-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |