C11H13ClN2 — CID 11572011
2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride (PubChem CID 11572011) has the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride.
| Compound Name | 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 11572011 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;hydrochloride |
| SMILES | Cl.c1ccc2c3c([nH]c2c1)CCNC3 |
| InChI | InChI=1S/C11H12N2.ClH/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10;/h1-4,12-13H,5-7H2;1H |
| InChIKey | VNAOGYKTNRGMRR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|