C13H16OS — CID 11572083
(2R,3E,5E)-1-phenylsulfanylhepta-3,5-dien-2-ol (PubChem CID 11572083) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is (2R,3E,5E)-1-phenylsulfanylhepta-3,5-dien-2-ol.
| Compound Name | (2R,3E,5E)-1-phenylsulfanylhepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 11572083 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | (2R,3E,5E)-1-phenylsulfanylhepta-3,5-dien-2-ol |
| SMILES | C/C=C/C=C/[C@@H](O)CSc1ccccc1 |
| InChI | InChI=1S/C13H16OS/c1-2-3-5-8-12(14)11-15-13-9-6-4-7-10-13/h2-10,12,14H,11H2,1H3/b3-2+,8-5+/t12-/m1/s1 |
| InChIKey | MBWLAEWKOIMMKF-QPCWHRKWSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|