C12H17ClN2 — CID 11572115
1-(4-chlorophenyl)-2,5-dimethylpiperazine (PubChem CID 11572115) has the molecular formula C12H17ClN2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2,5-dimethylpiperazine.
| Compound Name | 1-(4-chlorophenyl)-2,5-dimethylpiperazine |
|---|---|
| PubChem CID | 11572115 |
| Molecular Formula | C12H17ClN2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-(4-chlorophenyl)-2,5-dimethylpiperazine |
| SMILES | CC1CN(c2ccc(Cl)cc2)C(C)CN1 |
| InChI | InChI=1S/C12H17ClN2/c1-9-8-15(10(2)7-14-9)12-5-3-11(13)4-6-12/h3-6,9-10,14H,7-8H2,1-2H3 |
| InChIKey | FKRWBIHTHXSCHW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |