C13H29NO — CID 115721181
4,4-dimethyl-1-(4-methylpentan-2-ylamino)pentan-2-ol (PubChem CID 115721181) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is 4,4-dimethyl-1-(4-methylpentan-2-ylamino)pentan-2-ol.
| Compound Name | 4,4-dimethyl-1-(4-methylpentan-2-ylamino)pentan-2-ol |
|---|---|
| PubChem CID | 115721181 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | 4,4-dimethyl-1-(4-methylpentan-2-ylamino)pentan-2-ol |
| SMILES | CC(C)CC(C)NCC(O)CC(C)(C)C |
| InChI | InChI=1S/C13H29NO/c1-10(2)7-11(3)14-9-12(15)8-13(4,5)6/h10-12,14-15H,7-9H2,1-6H3 |
| InChIKey | JNIACYFGLUGURI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |