C13H20N2S — CID 115722083
N-(2-methyl-1-pyridin-2-ylpropyl)thiolan-3-amine (PubChem CID 115722083) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-(2-methyl-1-pyridin-2-ylpropyl)thiolan-3-amine.
| Compound Name | N-(2-methyl-1-pyridin-2-ylpropyl)thiolan-3-amine |
|---|---|
| PubChem CID | 115722083 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-(2-methyl-1-pyridin-2-ylpropyl)thiolan-3-amine |
| SMILES | CC(C)C(NC1CCSC1)c1ccccn1 |
| InChI | InChI=1S/C13H20N2S/c1-10(2)13(12-5-3-4-7-14-12)15-11-6-8-16-9-11/h3-5,7,10-11,13,15H,6,8-9H2,1-2H3 |
| InChIKey | CVMPYWJQECWPBL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |