About (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol
(1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol (PubChem CID 11572221) has the molecular formula C14H24OSi
and a molecular weight of 236.43 g/mol. Its IUPAC name is (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol |
| PubChem CID | 11572221 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol |
| SMILES | CC1=C(C#C[Si](C)(C)C)C(C)(C)CC[C@@H]1O |
| InChI | InChI=1S/C14H24OSi/c1-11-12(8-10-16(4,5)6)14(2,3)9-7-13(11)15/h13,15H,7,9H2,1-6H3/t13-/m0/s1 |
| InChIKey | ZDJYNZKYXACXSF-ZDUSSCGKSA-N |
| XLogP | 3.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol?
The IUPAC name of (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol (CID 11572221) is (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol.
What is the SMILES notation for (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol?
The canonical SMILES for (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol is CC1=C(C#C[Si](C)(C)C)C(C)(C)CC[C@@H]1O.
What is the InChIKey of (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol?
The InChIKey is ZDJYNZKYXACXSF-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H24OSi/c1-11-12(8-10-16(4,5)6)14(2,3)9-7-13(11)15/h13,15H,7,9H2,1-6H3/t13-/m0/s1.
What are the key properties of (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol?
(1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol has a molecular weight of 236.43 g/mol, XLogP of 3.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2,4,4-trimethyl-3-(2-trimethylsilylethynyl)cyclohex-2-en-1-ol is sourced from PubChem (CID 11572221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).