C13H27NOS — CID 115724640
N-(4-methoxy-4-methylpentan-2-yl)-3-methylsulfanylcyclopentan-1-amine (PubChem CID 115724640) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is N-(4-methoxy-4-methylpentan-2-yl)-3-methylsulfanylcyclopentan-1-amine.
| Compound Name | N-(4-methoxy-4-methylpentan-2-yl)-3-methylsulfanylcyclopentan-1-amine |
|---|---|
| PubChem CID | 115724640 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-(4-methoxy-4-methylpentan-2-yl)-3-methylsulfanylcyclopentan-1-amine |
| SMILES | COC(C)(C)CC(C)NC1CCC(SC)C1 |
| InChI | InChI=1S/C13H27NOS/c1-10(9-13(2,3)15-4)14-11-6-7-12(8-11)16-5/h10-12,14H,6-9H2,1-5H3 |
| InChIKey | OAQGPVXDRFVOSG-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |