About 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide
4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide (PubChem CID 1157247) has the molecular formula C17H18ClN3O2S
and a molecular weight of 363.87 g/mol. Its IUPAC name is 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide |
| PubChem CID | 1157247 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cn3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C17H18ClN3O2S/c1-3-21(4-2)24(22,23)15-8-5-13(6-9-15)16-12-20-11-14(18)7-10-17(20)19-16/h5-12H,3-4H2,1-2H3 |
| InChIKey | RFLWGSKFCPCEHC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide?
The IUPAC name of 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide (CID 1157247) is 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide.
What is the SMILES notation for 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide?
The canonical SMILES for 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide is CCN(CC)S(=O)(=O)c1ccc(-c2cn3cc(Cl)ccc3n2)cc1.
What is the InChIKey of 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide?
The InChIKey is RFLWGSKFCPCEHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18ClN3O2S/c1-3-21(4-2)24(22,23)15-8-5-13(6-9-15)16-12-20-11-14(18)7-10-17(20)19-16/h5-12H,3-4H2,1-2H3.
What are the key properties of 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide?
4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide has a molecular weight of 363.87 g/mol, XLogP of 3.69, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-chloroimidazo[1,2-a]pyridin-2-yl)-N,N-diethylbenzenesulfonamide is sourced from PubChem (CID 1157247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).