C14H18BrN — CID 115725334
N-[1-(3-bromophenyl)propyl]pent-4-yn-2-amine (PubChem CID 115725334) has the molecular formula C14H18BrN and a molecular weight of 280.21 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)propyl]pent-4-yn-2-amine.
| Compound Name | N-[1-(3-bromophenyl)propyl]pent-4-yn-2-amine |
|---|---|
| PubChem CID | 115725334 |
| Molecular Formula | C14H18BrN |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | N-[1-(3-bromophenyl)propyl]pent-4-yn-2-amine |
| SMILES | C#CCC(C)NC(CC)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H18BrN/c1-4-7-11(3)16-14(5-2)12-8-6-9-13(15)10-12/h1,6,8-11,14,16H,5,7H2,2-3H3 |
| InChIKey | PIEICTLHYCUHBE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|