C12H19FN2S — CID 115725711
1-ethylsulfanyl-N-[1-(5-fluoro-3-pyridinyl)ethyl]propan-2-amine (PubChem CID 115725711) has the molecular formula C12H19FN2S and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-ethylsulfanyl-N-[1-(5-fluoro-3-pyridinyl)ethyl]propan-2-amine.
| Compound Name | 1-ethylsulfanyl-N-[1-(5-fluoro-3-pyridinyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 115725711 |
| Molecular Formula | C12H19FN2S |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 1-ethylsulfanyl-N-[1-(5-fluoro-3-pyridinyl)ethyl]propan-2-amine |
| SMILES | CCSCC(C)NC(C)c1cncc(F)c1 |
| InChI | InChI=1S/C12H19FN2S/c1-4-16-8-9(2)15-10(3)11-5-12(13)7-14-6-11/h5-7,9-10,15H,4,8H2,1-3H3 |
| InChIKey | SBOGNQHWVLTPOU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |