C14H24F2N2O — CID 11572624
N-(4,4-difluorocyclohexyl)-1-propylpyrrolidine-2-carboxamide (PubChem CID 11572624) has the molecular formula C14H24F2N2O and a molecular weight of 274.35 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-1-propylpyrrolidine-2-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-1-propylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11572624 |
| Molecular Formula | C14H24F2N2O |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-1-propylpyrrolidine-2-carboxamide |
| SMILES | CCCN1CCCC1C(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H24F2N2O/c1-2-9-18-10-3-4-12(18)13(19)17-11-5-7-14(15,16)8-6-11/h11-12H,2-10H2,1H3,(H,17,19) |
| InChIKey | HJDRJGUHPHBODY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |