About N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine
N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine (PubChem CID 11572645) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine |
| PubChem CID | 11572645 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine |
| SMILES | c1ccc(-c2cnc(Nc3ccc4c(c3)CCC4)o2)cc1 |
| InChI | InChI=1S/C18H16N2O/c1-2-5-14(6-3-1)17-12-19-18(21-17)20-16-10-9-13-7-4-8-15(13)11-16/h1-3,5-6,9-12H,4,7-8H2,(H,19,20) |
| InChIKey | CSRSLTMAJOAKFA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine?
The IUPAC name of N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine (CID 11572645) is N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine.
What is the SMILES notation for N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine?
The canonical SMILES for N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine is c1ccc(-c2cnc(Nc3ccc4c(c3)CCC4)o2)cc1.
What is the InChIKey of N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine?
The InChIKey is CSRSLTMAJOAKFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O/c1-2-5-14(6-3-1)17-12-19-18(21-17)20-16-10-9-13-7-4-8-15(13)11-16/h1-3,5-6,9-12H,4,7-8H2,(H,19,20).
What are the key properties of N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine?
N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine has a molecular weight of 276.34 g/mol, XLogP of 4.57, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,3-dihydro-1H-inden-5-yl)-5-phenyl-1,3-oxazol-2-amine is sourced from PubChem (CID 11572645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).