C17H28O3 — CID 11572720
ethyl 2-[(2R,3R,3aR,5aR,6S,9aS)-6-hydroxy-3-methyl-2,3,3a,4,5,5a,6,7,8,9-decahydro-1H-cyclopenta[i]inden-2-yl]acetate (PubChem CID 11572720) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is ethyl 2-[(2R,3R,3aR,5aR,6S,9aS)-6-hydroxy-3-methyl-2,3,3a,4,5,5a,6,7,8,9-decahydro-1H-cyclopenta[i]inden-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,3R,3aR,5aR,6S,9aS)-6-hydroxy-3-methyl-2,3,3a,4,5,5a,6,7,8,9-decahydro-1H-cyclopenta[i]inden-2-yl]acetate |
|---|---|
| PubChem CID | 11572720 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | ethyl 2-[(2R,3R,3aR,5aR,6S,9aS)-6-hydroxy-3-methyl-2,3,3a,4,5,5a,6,7,8,9-decahydro-1H-cyclopenta[i]inden-2-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@]23CCC[C@H](O)[C@@H]2CC[C@@H]3[C@@H]1C |
| InChI | InChI=1S/C17H28O3/c1-3-20-16(19)9-12-10-17-8-4-5-15(18)14(17)7-6-13(17)11(12)2/h11-15,18H,3-10H2,1-2H3/t11-,12+,13-,14+,15+,17+/m1/s1 |
| InChIKey | PKDHJINFDNNQBL-REISYBLGSA-N |
| XLogP | 3.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |