C16H16N2OS — CID 11572774
spiro[1H-chromeno[4,3-d]pyrimidine-5,1'-cyclohexane]-2-thione (PubChem CID 11572774) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is spiro[1H-chromeno[4,3-d]pyrimidine-5,1'-cyclohexane]-2-thione.
| Compound Name | spiro[1H-chromeno[4,3-d]pyrimidine-5,1'-cyclohexane]-2-thione |
|---|---|
| PubChem CID | 11572774 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | spiro[1H-chromeno[4,3-d]pyrimidine-5,1'-cyclohexane]-2-thione |
| SMILES | S=c1ncc2c([nH]1)-c1ccccc1OC21CCCCC1 |
| InChI | InChI=1S/C16H16N2OS/c20-15-17-10-12-14(18-15)11-6-2-3-7-13(11)19-16(12)8-4-1-5-9-16/h2-3,6-7,10H,1,4-5,8-9H2,(H,17,18,20) |
| InChIKey | AKSAOGODZLOMOA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|