C13H10N2O6 — CID 11572844
4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid (PubChem CID 11572844) has the molecular formula C13H10N2O6 and a molecular weight of 290.23 g/mol. Its IUPAC name is 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid.
| Compound Name | 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 11572844 |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1ccc2c(c1)C(=O)C(=O)NC2=O |
| InChI | InChI=1S/C13H10N2O6/c16-9(3-4-10(17)18)14-6-1-2-7-8(5-6)11(19)13(21)15-12(7)20/h1-2,5H,3-4H2,(H,14,16)(H,17,18)(H,15,20,21) |
| InChIKey | RZIOHTDLDUFVCW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|