4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid

C13H10N2O6 — CID 11572844

IUPAC4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid
SMILESO=C(O)CCC(=O)Nc1ccc2c(c1)C(=O)C(=O)NC2=O
InChIInChI=1S/C13H10N2O6/c16-9(3-4-10(17)18)14-6-1-2-7-8(5-6)11(19)13(21)15-12(7)20/h1-2,5H,3-4H2,(H,14,16)(H,17,18)(H,15,20,21)
InChIKeyRZIOHTDLDUFVCW-UHFFFAOYSA-N
MW290.23 g/mol
LogP-0.06
Rot. Bonds4

About 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid

4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid (PubChem CID 11572844) has the molecular formula C13H10N2O6 and a molecular weight of 290.23 g/mol. Its IUPAC name is 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid.

Molecular Properties

Compound Name4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid
PubChem CID11572844
Molecular FormulaC13H10N2O6
Molecular Weight290.23 g/mol
Exact Mass290.05
IUPAC Name4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid
SMILESO=C(O)CCC(=O)Nc1ccc2c(c1)C(=O)C(=O)NC2=O
InChIInChI=1S/C13H10N2O6/c16-9(3-4-10(17)18)14-6-1-2-7-8(5-6)11(19)13(21)15-12(7)20/h1-2,5H,3-4H2,(H,14,16)(H,17,18)(H,15,20,21)
InChIKeyRZIOHTDLDUFVCW-UHFFFAOYSA-N
XLogP-0.06
TPSA129.64 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.23
LogP ≤ 5-0.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid?
The IUPAC name of 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid (CID 11572844) is 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid.
What is the SMILES notation for 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid?
The canonical SMILES for 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid is O=C(O)CCC(=O)Nc1ccc2c(c1)C(=O)C(=O)NC2=O.
What is the InChIKey of 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid?
The InChIKey is RZIOHTDLDUFVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O6/c16-9(3-4-10(17)18)14-6-1-2-7-8(5-6)11(19)13(21)15-12(7)20/h1-2,5H,3-4H2,(H,14,16)(H,17,18)(H,15,20,21).
What are the key properties of 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid?
4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid has a molecular weight of 290.23 g/mol, XLogP of -0.06, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-[(1,3,4-trioxoisoquinolin-6-yl)amino]butanoic acid is sourced from PubChem (CID 11572844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).