C11H20N2O — CID 115728485
3-(cyclopent-3-en-1-ylamino)-N,N-dimethylbutanamide (PubChem CID 115728485) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 3-(cyclopent-3-en-1-ylamino)-N,N-dimethylbutanamide.
| Compound Name | 3-(cyclopent-3-en-1-ylamino)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 115728485 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 3-(cyclopent-3-en-1-ylamino)-N,N-dimethylbutanamide |
| SMILES | CC(CC(=O)N(C)C)NC1CC=CC1 |
| InChI | InChI=1S/C11H20N2O/c1-9(8-11(14)13(2)3)12-10-6-4-5-7-10/h4-5,9-10,12H,6-8H2,1-3H3 |
| InChIKey | ORGKGXKSQQETCB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|