C18H26O3 — CID 11572858
1-[(4S,5S)-5-(2-ethenylbuta-1,3-dienyl)-2,2-diethyl-1,3-dioxolan-4-yl]-2-methylidenebutan-1-one (PubChem CID 11572858) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is 1-[(4S,5S)-5-(2-ethenylbuta-1,3-dienyl)-2,2-diethyl-1,3-dioxolan-4-yl]-2-methylidenebutan-1-one.
| Compound Name | 1-[(4S,5S)-5-(2-ethenylbuta-1,3-dienyl)-2,2-diethyl-1,3-dioxolan-4-yl]-2-methylidenebutan-1-one |
|---|---|
| PubChem CID | 11572858 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 1-[(4S,5S)-5-(2-ethenylbuta-1,3-dienyl)-2,2-diethyl-1,3-dioxolan-4-yl]-2-methylidenebutan-1-one |
| SMILES | C=CC(C=C)=C[C@@H]1OC(CC)(CC)O[C@@H]1C(=O)C(=C)CC |
| InChI | InChI=1S/C18H26O3/c1-7-13(6)16(19)17-15(12-14(8-2)9-3)20-18(10-4,11-5)21-17/h8-9,12,15,17H,2-3,6-7,10-11H2,1,4-5H3/t15-,17-/m0/s1 |
| InChIKey | PAZMARWBJJVDIC-RDJZCZTQSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|