C12H22N2OS — CID 115729166
1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentan-3-ol (PubChem CID 115729166) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is 1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentan-3-ol.
| Compound Name | 1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentan-3-ol |
|---|---|
| PubChem CID | 115729166 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethylamino]pentan-3-ol |
| SMILES | CCC(O)CCNC(C)c1sc(C)nc1C |
| InChI | InChI=1S/C12H22N2OS/c1-5-11(15)6-7-13-8(2)12-9(3)14-10(4)16-12/h8,11,13,15H,5-7H2,1-4H3 |
| InChIKey | XACHTAZFIBZJCZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |