C20H22O2 — CID 11572925
(4bR,8aR,9R)-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-3-ol (PubChem CID 11572925) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (4bR,8aR,9R)-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-3-ol.
| Compound Name | (4bR,8aR,9R)-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-3-ol |
|---|---|
| PubChem CID | 11572925 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (4bR,8aR,9R)-9-(4-hydroxyphenyl)-4b,5,6,7,8,8a,9,10-octahydrophenanthren-3-ol |
| SMILES | Oc1ccc([C@@H]2Cc3ccc(O)cc3[C@@H]3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C20H22O2/c21-15-8-5-13(6-9-15)19-11-14-7-10-16(22)12-20(14)18-4-2-1-3-17(18)19/h5-10,12,17-19,21-22H,1-4,11H2/t17-,18+,19-/m0/s1 |
| InChIKey | NDEUMYWIDXAPHI-OTWHNJEPSA-N |
| XLogP | 4.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |