C8H9N3O3 — CID 115730014
3-(pyrimidine-2-carbonylamino)propanoic acid (PubChem CID 115730014) has the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. Its IUPAC name is 3-(pyrimidine-2-carbonylamino)propanoic acid.
| Compound Name | 3-(pyrimidine-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 115730014 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 3-(pyrimidine-2-carbonylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ncccn1 |
| InChI | InChI=1S/C8H9N3O3/c12-6(13)2-5-11-8(14)7-9-3-1-4-10-7/h1,3-4H,2,5H2,(H,11,14)(H,12,13) |
| InChIKey | JQRHYQZAXALXPG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |