C11H16FNO3 — CID 115731688
3-fluoro-1-[(Z)-2-methylpent-2-enoyl]pyrrolidine-3-carboxylic acid (PubChem CID 115731688) has the molecular formula C11H16FNO3 and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-fluoro-1-[(Z)-2-methylpent-2-enoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-fluoro-1-[(Z)-2-methylpent-2-enoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 115731688 |
| Molecular Formula | C11H16FNO3 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-fluoro-1-[(Z)-2-methylpent-2-enoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC/C=C(/C)C(=O)N1CCC(F)(C(=O)O)C1 |
| InChI | InChI=1S/C11H16FNO3/c1-3-4-8(2)9(14)13-6-5-11(12,7-13)10(15)16/h4H,3,5-7H2,1-2H3,(H,15,16)/b8-4- |
| InChIKey | OCLUQQULVUDAEZ-YWEYNIOJSA-N |
| XLogP | 1.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|