About [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol
[1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol (PubChem CID 115731858) has the molecular formula C13H17N3OS
and a molecular weight of 263.37 g/mol. Its IUPAC name is [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol.
Molecular Properties
| Compound Name | [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol |
| PubChem CID | 115731858 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol |
| SMILES | Cc1sc2ncnc(NC3(CO)CCC3)c2c1C |
| InChI | InChI=1S/C13H17N3OS/c1-8-9(2)18-12-10(8)11(14-7-15-12)16-13(6-17)4-3-5-13/h7,17H,3-6H2,1-2H3,(H,14,15,16) |
| InChIKey | SPSFMAWHYUDNCF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol?
The IUPAC name of [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol (CID 115731858) is [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol.
What is the SMILES notation for [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol?
The canonical SMILES for [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol is Cc1sc2ncnc(NC3(CO)CCC3)c2c1C.
What is the InChIKey of [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol?
The InChIKey is SPSFMAWHYUDNCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3OS/c1-8-9(2)18-12-10(8)11(14-7-15-12)16-13(6-17)4-3-5-13/h7,17H,3-6H2,1-2H3,(H,14,15,16).
What are the key properties of [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol?
[1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol has a molecular weight of 263.37 g/mol, XLogP of 2.64, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]cyclobutyl]methanol is sourced from PubChem (CID 115731858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).