About 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine
1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine (PubChem CID 11573193) has the molecular formula C21H29NO
and a molecular weight of 311.47 g/mol. Its IUPAC name is 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine |
| PubChem CID | 11573193 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine |
| SMILES | COc1ccc2c(CCCN3CCCC(C)(C)C3)cccc2c1 |
| InChI | InChI=1S/C21H29NO/c1-21(2)12-6-14-22(16-21)13-5-9-17-7-4-8-18-15-19(23-3)10-11-20(17)18/h4,7-8,10-11,15H,5-6,9,12-14,16H2,1-3H3 |
| InChIKey | PIILAVXTKIZGHR-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine?
The IUPAC name of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine (CID 11573193) is 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine.
What is the SMILES notation for 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine?
The canonical SMILES for 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine is COc1ccc2c(CCCN3CCCC(C)(C)C3)cccc2c1.
What is the InChIKey of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine?
The InChIKey is PIILAVXTKIZGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29NO/c1-21(2)12-6-14-22(16-21)13-5-9-17-7-4-8-18-15-19(23-3)10-11-20(17)18/h4,7-8,10-11,15H,5-6,9,12-14,16H2,1-3H3.
What are the key properties of 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine?
1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine has a molecular weight of 311.47 g/mol, XLogP of 4.90, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(6-methoxynaphthalen-1-yl)propyl]-3,3-dimethylpiperidine is sourced from PubChem (CID 11573193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).