C15H20Cl2N2O — CID 11573245
(3aR,9bS)-6-chloro-4,8-diethyl-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride (PubChem CID 11573245) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is (3aR,9bS)-6-chloro-4,8-diethyl-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride.
| Compound Name | (3aR,9bS)-6-chloro-4,8-diethyl-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride |
|---|---|
| PubChem CID | 11573245 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (3aR,9bS)-6-chloro-4,8-diethyl-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride |
| SMILES | CCc1cc(Cl)c2c(c1)[C@H]1CNC[C@@H]1N(CC)C2=O.Cl |
| InChI | InChI=1S/C15H19ClN2O.ClH/c1-3-9-5-10-11-7-17-8-13(11)18(4-2)15(19)14(10)12(16)6-9;/h5-6,11,13,17H,3-4,7-8H2,1-2H3;1H/t11-,13+;/m1./s1 |
| InChIKey | AJKIWQQEMCQXDZ-YLAFAASESA-N |
| XLogP | 2.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |