About 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine
1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine (PubChem CID 115732524) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine.
Analyze 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine?
The IUPAC name of 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine (CID 115732524) is 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine.
What is the SMILES notation for 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine?
The canonical SMILES for 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine is CC1(NCc2cncs2)CC1.
What is the InChIKey of 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine?
The InChIKey is OFSBCXLOPRTRCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-8(2-3-8)10-5-7-4-9-6-11-7/h4,6,10H,2-3,5H2,1H3.
What are the key properties of 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine?
1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine has a molecular weight of 168.26 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-(1,3-thiazol-5-ylmethyl)cyclopropan-1-amine is sourced from PubChem (CID 115732524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).