C13H25NOS — CID 115732714
3-[[(3,3-dimethylcyclohexyl)amino]methyl]thiolan-3-ol (PubChem CID 115732714) has the molecular formula C13H25NOS and a molecular weight of 243.42 g/mol. Its IUPAC name is 3-[[(3,3-dimethylcyclohexyl)amino]methyl]thiolan-3-ol.
| Compound Name | 3-[[(3,3-dimethylcyclohexyl)amino]methyl]thiolan-3-ol |
|---|---|
| PubChem CID | 115732714 |
| Molecular Formula | C13H25NOS |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 3-[[(3,3-dimethylcyclohexyl)amino]methyl]thiolan-3-ol |
| SMILES | CC1(C)CCCC(NCC2(O)CCSC2)C1 |
| InChI | InChI=1S/C13H25NOS/c1-12(2)5-3-4-11(8-12)14-9-13(15)6-7-16-10-13/h11,14-15H,3-10H2,1-2H3 |
| InChIKey | PECRMTJHOXWDNF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |