C19H23ClO2 — CID 11573293
(8R,9S,13S,14S)-2-chloro-13-ethyl-3-hydroxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 11573293) has the molecular formula C19H23ClO2 and a molecular weight of 318.84 g/mol. Its IUPAC name is (8R,9S,13S,14S)-2-chloro-13-ethyl-3-hydroxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-2-chloro-13-ethyl-3-hydroxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11573293 |
| Molecular Formula | C19H23ClO2 |
| Molecular Weight | 318.84 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (8R,9S,13S,14S)-2-chloro-13-ethyl-3-hydroxy-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | CC[C@]12CC[C@@H]3c4cc(Cl)c(O)cc4CC[C@H]3[C@@H]1CCC2=O |
| InChI | InChI=1S/C19H23ClO2/c1-2-19-8-7-12-13(15(19)5-6-18(19)22)4-3-11-9-17(21)16(20)10-14(11)12/h9-10,12-13,15,21H,2-8H2,1H3/t12-,13+,15-,19-/m0/s1 |
| InChIKey | QMLGODKJXNTJIN-QPWUGHHJSA-N |
| XLogP | 4.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.84 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |