About 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine
3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine (PubChem CID 115732987) has the molecular formula C10H18FN3O
and a molecular weight of 215.27 g/mol. Its IUPAC name is 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine |
| PubChem CID | 115732987 |
| Molecular Formula | C10H18FN3O |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine |
| SMILES | COc1c(CNCCCF)c(C)nn1C |
| InChI | InChI=1S/C10H18FN3O/c1-8-9(7-12-6-4-5-11)10(15-3)14(2)13-8/h12H,4-7H2,1-3H3 |
| InChIKey | YYUHRJYLZQQSKX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine?
The IUPAC name of 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine (CID 115732987) is 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine.
What is the SMILES notation for 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine?
The canonical SMILES for 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine is COc1c(CNCCCF)c(C)nn1C.
What is the InChIKey of 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine?
The InChIKey is YYUHRJYLZQQSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FN3O/c1-8-9(7-12-6-4-5-11)10(15-3)14(2)13-8/h12H,4-7H2,1-3H3.
What are the key properties of 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine?
3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine has a molecular weight of 215.27 g/mol, XLogP of 1.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-N-[(5-methoxy-1,3-dimethylpyrazol-4-yl)methyl]propan-1-amine is sourced from PubChem (CID 115732987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).