About 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol
5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol (PubChem CID 11573431) has the molecular formula C17H17N3O4
and a molecular weight of 327.34 g/mol. Its IUPAC name is 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol |
| PubChem CID | 11573431 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol |
| SMILES | COc1ccc(-c2cn(-c3ccc(OC)c(OC)c3)nn2)cc1O |
| InChI | InChI=1S/C17H17N3O4/c1-22-15-6-4-11(8-14(15)21)13-10-20(19-18-13)12-5-7-16(23-2)17(9-12)24-3/h4-10,21H,1-3H3 |
| InChIKey | YLTGQKJEVCCKLM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol?
The IUPAC name of 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol (CID 11573431) is 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol.
What is the SMILES notation for 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol?
The canonical SMILES for 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol is COc1ccc(-c2cn(-c3ccc(OC)c(OC)c3)nn2)cc1O.
What is the InChIKey of 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol?
The InChIKey is YLTGQKJEVCCKLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O4/c1-22-15-6-4-11(8-14(15)21)13-10-20(19-18-13)12-5-7-16(23-2)17(9-12)24-3/h4-10,21H,1-3H3.
What are the key properties of 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol?
5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol has a molecular weight of 327.34 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(3,4-dimethoxyphenyl)triazol-4-yl]-2-methoxyphenol is sourced from PubChem (CID 11573431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).