C10H18N4O2 — CID 115735088
N-(1-hydroxypentan-3-yl)-3-(1,2,4-triazol-1-yl)propanamide (PubChem CID 115735088) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-(1-hydroxypentan-3-yl)-3-(1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-(1-hydroxypentan-3-yl)-3-(1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 115735088 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | N-(1-hydroxypentan-3-yl)-3-(1,2,4-triazol-1-yl)propanamide |
| SMILES | CCC(CCO)NC(=O)CCn1cncn1 |
| InChI | InChI=1S/C10H18N4O2/c1-2-9(4-6-15)13-10(16)3-5-14-8-11-7-12-14/h7-9,15H,2-6H2,1H3,(H,13,16) |
| InChIKey | UTBSYZYCHNSUFY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |