C12H11N3S — CID 115735493
5-[[(3-methyl-2-pyridinyl)amino]methyl]thiophene-3-carbonitrile (PubChem CID 115735493) has the molecular formula C12H11N3S and a molecular weight of 229.31 g/mol. Its IUPAC name is 5-[[(3-methyl-2-pyridinyl)amino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[(3-methyl-2-pyridinyl)amino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 115735493 |
| Molecular Formula | C12H11N3S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 5-[[(3-methyl-2-pyridinyl)amino]methyl]thiophene-3-carbonitrile |
| SMILES | Cc1cccnc1NCc1cc(C#N)cs1 |
| InChI | InChI=1S/C12H11N3S/c1-9-3-2-4-14-12(9)15-7-11-5-10(6-13)8-16-11/h2-5,8H,7H2,1H3,(H,14,15) |
| InChIKey | ZJAAARCUMWAIJQ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |