C11H16N2O2S — CID 115735693
5-[[(2-hydroxycyclopentyl)amino]methyl]thiophene-3-carboxamide (PubChem CID 115735693) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 5-[[(2-hydroxycyclopentyl)amino]methyl]thiophene-3-carboxamide.
| Compound Name | 5-[[(2-hydroxycyclopentyl)amino]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 115735693 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 5-[[(2-hydroxycyclopentyl)amino]methyl]thiophene-3-carboxamide |
| SMILES | NC(=O)c1csc(CNC2CCCC2O)c1 |
| InChI | InChI=1S/C11H16N2O2S/c12-11(15)7-4-8(16-6-7)5-13-9-2-1-3-10(9)14/h4,6,9-10,13-14H,1-3,5H2,(H2,12,15) |
| InChIKey | JEBSUUUJGHVQJS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |