C15H10Cl2F2O2 — CID 115736583
2-(2,5-dichlorophenyl)-1-[2-(difluoromethoxy)phenyl]ethanone (PubChem CID 115736583) has the molecular formula C15H10Cl2F2O2 and a molecular weight of 331.15 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-1-[2-(difluoromethoxy)phenyl]ethanone.
| Compound Name | 2-(2,5-dichlorophenyl)-1-[2-(difluoromethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 115736583 |
| Molecular Formula | C15H10Cl2F2O2 |
| Molecular Weight | 331.15 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-1-[2-(difluoromethoxy)phenyl]ethanone |
| SMILES | O=C(Cc1cc(Cl)ccc1Cl)c1ccccc1OC(F)F |
| InChI | InChI=1S/C15H10Cl2F2O2/c16-10-5-6-12(17)9(7-10)8-13(20)11-3-1-2-4-14(11)21-15(18)19/h1-7,15H,8H2 |
| InChIKey | HOOBPAMUTARMDQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.15 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |