C21H24O4 — CID 11573669
benzyl (1R,3aR,8aS,9S,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxylate (PubChem CID 11573669) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is benzyl (1R,3aR,8aS,9S,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxylate.
| Compound Name | benzyl (1R,3aR,8aS,9S,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxylate |
|---|---|
| PubChem CID | 11573669 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | benzyl (1R,3aR,8aS,9S,9aR)-1-methyl-3-oxo-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxylate |
| SMILES | C[C@H]1OC(=O)[C@@H]2C=C3CCCC[C@H]3[C@H](C(=O)OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C21H24O4/c1-13-18-17(20(22)25-13)11-15-9-5-6-10-16(15)19(18)21(23)24-12-14-7-3-2-4-8-14/h2-4,7-8,11,13,16-19H,5-6,9-10,12H2,1H3/t13-,16-,17-,18-,19+/m1/s1 |
| InChIKey | FNBAFCGRPFLZBV-PYJZQUQOSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|