C17H18N2O4S — CID 11573782
2-[(2-aminophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 11573782) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[(2-aminophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
| Compound Name | 2-[(2-aminophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 11573782 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[(2-aminophenyl)sulfonylamino]-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid |
| SMILES | Nc1ccccc1S(=O)(=O)Nc1ccc2c(c1C(=O)O)CCCC2 |
| InChI | InChI=1S/C17H18N2O4S/c18-13-7-3-4-8-15(13)24(22,23)19-14-10-9-11-5-1-2-6-12(11)16(14)17(20)21/h3-4,7-10,19H,1-2,5-6,18H2,(H,20,21) |
| InChIKey | YNEHJMCKHQLISR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|