C21H35NO3 — CID 11573848
(5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-N-methylicosa-6,8,10,14-tetraenamide (PubChem CID 11573848) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-N-methylicosa-6,8,10,14-tetraenamide.
| Compound Name | (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-N-methylicosa-6,8,10,14-tetraenamide |
|---|---|
| PubChem CID | 11573848 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | (5S,6Z,8E,10E,12R,14Z)-5,12-dihydroxy-N-methylicosa-6,8,10,14-tetraenamide |
| SMILES | CCCCC/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)NC |
| InChI | InChI=1S/C21H35NO3/c1-3-4-5-6-7-10-14-19(23)15-11-8-9-12-16-20(24)17-13-18-21(25)22-2/h7-12,15-16,19-20,23-24H,3-6,13-14,17-18H2,1-2H3,(H,22,25)/b9-8+,10-7-,15-11+,16-12-/t19-,20-/m1/s1 |
| InChIKey | APXYMIPRWYZTBI-YUYWXVMBSA-N |
| XLogP | 3.82 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|