C13H25N3OS — CID 115739169
2-methyl-1-(2-methylthiomorpholin-4-yl)-2-piperazin-1-ylpropan-1-one (PubChem CID 115739169) has the molecular formula C13H25N3OS and a molecular weight of 271.43 g/mol. Its IUPAC name is 2-methyl-1-(2-methylthiomorpholin-4-yl)-2-piperazin-1-ylpropan-1-one.
| Compound Name | 2-methyl-1-(2-methylthiomorpholin-4-yl)-2-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 115739169 |
| Molecular Formula | C13H25N3OS |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2-methyl-1-(2-methylthiomorpholin-4-yl)-2-piperazin-1-ylpropan-1-one |
| SMILES | CC1CN(C(=O)C(C)(C)N2CCNCC2)CCS1 |
| InChI | InChI=1S/C13H25N3OS/c1-11-10-15(8-9-18-11)12(17)13(2,3)16-6-4-14-5-7-16/h11,14H,4-10H2,1-3H3 |
| InChIKey | FXGXCLGRFWKHFE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |